C32H40N2O3 — CID 175706798
2-methyl-3,4,5-tris(phenylmethoxy)-1-[[(3R)-pyrrolidin-3-yl]methyl]piperidine (PubChem CID 175706798) has the molecular formula C32H40N2O3 and a molecular weight of 500.68 g/mol. Its IUPAC name is 2-methyl-3,4,5-tris(phenylmethoxy)-1-[[(3R)-pyrrolidin-3-yl]methyl]piperidine.
| Compound Name | 2-methyl-3,4,5-tris(phenylmethoxy)-1-[[(3R)-pyrrolidin-3-yl]methyl]piperidine |
|---|---|
| PubChem CID | 175706798 |
| Molecular Formula | C32H40N2O3 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.30 |
| IUPAC Name | 2-methyl-3,4,5-tris(phenylmethoxy)-1-[[(3R)-pyrrolidin-3-yl]methyl]piperidine |
| SMILES | CC1C(OCc2ccccc2)C(OCc2ccccc2)C(OCc2ccccc2)CN1C[C@@H]1CCNC1 |
| InChI | InChI=1S/C32H40N2O3/c1-25-31(36-23-27-13-7-3-8-14-27)32(37-24-28-15-9-4-10-16-28)30(35-22-26-11-5-2-6-12-26)21-34(25)20-29-17-18-33-19-29/h2-16,25,29-33H,17-24H2,1H3/t25?,29-,30?,31?,32?/m1/s1 |
| InChIKey | NPKPFBLNKFURRZ-OWOSJHDSSA-N |
| XLogP | 5.06 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |