C32H40N2O3 — CID 157039183
3,4,5-tris(phenylmethoxy)-1-[[(3R)-piperidin-3-yl]methyl]piperidine (PubChem CID 157039183) has the molecular formula C32H40N2O3 and a molecular weight of 500.68 g/mol. Its IUPAC name is 3,4,5-tris(phenylmethoxy)-1-[[(3R)-piperidin-3-yl]methyl]piperidine.
| Compound Name | 3,4,5-tris(phenylmethoxy)-1-[[(3R)-piperidin-3-yl]methyl]piperidine |
|---|---|
| PubChem CID | 157039183 |
| Molecular Formula | C32H40N2O3 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.30 |
| IUPAC Name | 3,4,5-tris(phenylmethoxy)-1-[[(3R)-piperidin-3-yl]methyl]piperidine |
| SMILES | c1ccc(COC2CN(C[C@@H]3CCCNC3)CC(OCc3ccccc3)C2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C32H40N2O3/c1-4-11-26(12-5-1)23-35-30-21-34(20-29-17-10-18-33-19-29)22-31(36-24-27-13-6-2-7-14-27)32(30)37-25-28-15-8-3-9-16-28/h1-9,11-16,29-33H,10,17-25H2/t29-,30?,31?,32?/m1/s1 |
| InChIKey | CBUPCTFXFPDMQO-XWFMAZOLSA-N |
| XLogP | 5.06 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |