C33H42N2O3 — CID 155286796
(2R,3R,4R,5S)-2-methyl-3,4,5-tris(phenylmethoxy)-1-[[(3R)-piperidin-3-yl]methyl]piperidine (PubChem CID 155286796) has the molecular formula C33H42N2O3 and a molecular weight of 514.71 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-methyl-3,4,5-tris(phenylmethoxy)-1-[[(3R)-piperidin-3-yl]methyl]piperidine.
| Compound Name | (2R,3R,4R,5S)-2-methyl-3,4,5-tris(phenylmethoxy)-1-[[(3R)-piperidin-3-yl]methyl]piperidine |
|---|---|
| PubChem CID | 155286796 |
| Molecular Formula | C33H42N2O3 |
| Molecular Weight | 514.71 g/mol |
| Exact Mass | 514.32 |
| IUPAC Name | (2R,3R,4R,5S)-2-methyl-3,4,5-tris(phenylmethoxy)-1-[[(3R)-piperidin-3-yl]methyl]piperidine |
| SMILES | C[C@@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)CN1C[C@@H]1CCCNC1 |
| InChI | InChI=1S/C33H42N2O3/c1-26-32(37-24-28-14-7-3-8-15-28)33(38-25-29-16-9-4-10-17-29)31(36-23-27-12-5-2-6-13-27)22-35(26)21-30-18-11-19-34-20-30/h2-10,12-17,26,30-34H,11,18-25H2,1H3/t26-,30-,31+,32-,33-/m1/s1 |
| InChIKey | BLJYCQYYPZLHOF-VFBKNBMOSA-N |
| XLogP | 5.45 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.71 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |