C36H42N2O3S — CID 155286497
(2R,3R,4R,5S)-2-methyl-3,4,5-tris(phenylmethoxy)-1-[(1-thiophen-3-ylpyrrolidin-3-yl)methyl]piperidine (PubChem CID 155286497) has the molecular formula C36H42N2O3S and a molecular weight of 582.81 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-methyl-3,4,5-tris(phenylmethoxy)-1-[(1-thiophen-3-ylpyrrolidin-3-yl)methyl]piperidine.
| Compound Name | (2R,3R,4R,5S)-2-methyl-3,4,5-tris(phenylmethoxy)-1-[(1-thiophen-3-ylpyrrolidin-3-yl)methyl]piperidine |
|---|---|
| PubChem CID | 155286497 |
| Molecular Formula | C36H42N2O3S |
| Molecular Weight | 582.81 g/mol |
| Exact Mass | 582.29 |
| IUPAC Name | (2R,3R,4R,5S)-2-methyl-3,4,5-tris(phenylmethoxy)-1-[(1-thiophen-3-ylpyrrolidin-3-yl)methyl]piperidine |
| SMILES | C[C@@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)CN1CC1CCN(c2ccsc2)C1 |
| InChI | InChI=1S/C36H42N2O3S/c1-28-35(40-25-30-13-7-3-8-14-30)36(41-26-31-15-9-4-10-16-31)34(39-24-29-11-5-2-6-12-29)23-38(28)22-32-17-19-37(21-32)33-18-20-42-27-33/h2-16,18,20,27-28,32,34-36H,17,19,21-26H2,1H3/t28-,32?,34+,35-,36-/m1/s1 |
| InChIKey | QPBBFKRAEPQLBB-AGMZGLBISA-N |
| XLogP | 7.03 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.81 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |