C40H43F3N2O4 — CID 155721033
[(3R)-3-[[(2R,3R,4R,5S)-2-methyl-3,4,5-tris(phenylmethoxy)piperidin-1-yl]methyl]pyrrolidin-1-yl]-[4-(trifluoromethyl)phenyl]methanone (PubChem CID 155721033) has the molecular formula C40H43F3N2O4 and a molecular weight of 672.79 g/mol. Its IUPAC name is [(3R)-3-[[(2R,3R,4R,5S)-2-methyl-3,4,5-tris(phenylmethoxy)piperidin-1-yl]methyl]pyrrolidin-1-yl]-[4-(trifluoromethyl)phenyl]methanone.
| Compound Name | [(3R)-3-[[(2R,3R,4R,5S)-2-methyl-3,4,5-tris(phenylmethoxy)piperidin-1-yl]methyl]pyrrolidin-1-yl]-[4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 155721033 |
| Molecular Formula | C40H43F3N2O4 |
| Molecular Weight | 672.79 g/mol |
| Exact Mass | 672.32 |
| IUPAC Name | [(3R)-3-[[(2R,3R,4R,5S)-2-methyl-3,4,5-tris(phenylmethoxy)piperidin-1-yl]methyl]pyrrolidin-1-yl]-[4-(trifluoromethyl)phenyl]methanone |
| SMILES | C[C@@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)CN1C[C@H]1CCN(C(=O)c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C40H43F3N2O4/c1-29-37(48-27-31-13-7-3-8-14-31)38(49-28-32-15-9-4-10-16-32)36(47-26-30-11-5-2-6-12-30)25-45(29)24-33-21-22-44(23-33)39(46)34-17-19-35(20-18-34)40(41,42)43/h2-20,29,33,36-38H,21-28H2,1H3/t29-,33+,36+,37-,38-/m1/s1 |
| InChIKey | CANVMWDEPHVVSS-UDCMDSRNSA-N |
| XLogP | 7.63 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.79 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |