C39H43F3N2O4 — CID 155721008
(2R,3R,4R,5S)-2-methyl-3,4,5-tris(phenylmethoxy)-1-[[(3R)-1-[2-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]methyl]piperidine (PubChem CID 155721008) has the molecular formula C39H43F3N2O4 and a molecular weight of 660.78 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-methyl-3,4,5-tris(phenylmethoxy)-1-[[(3R)-1-[2-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]methyl]piperidine.
| Compound Name | (2R,3R,4R,5S)-2-methyl-3,4,5-tris(phenylmethoxy)-1-[[(3R)-1-[2-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]methyl]piperidine |
|---|---|
| PubChem CID | 155721008 |
| Molecular Formula | C39H43F3N2O4 |
| Molecular Weight | 660.78 g/mol |
| Exact Mass | 660.32 |
| IUPAC Name | (2R,3R,4R,5S)-2-methyl-3,4,5-tris(phenylmethoxy)-1-[[(3R)-1-[2-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]methyl]piperidine |
| SMILES | C[C@@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)CN1C[C@H]1CCN(c2ccccc2OC(F)(F)F)C1 |
| InChI | InChI=1S/C39H43F3N2O4/c1-29-37(46-27-31-15-7-3-8-16-31)38(47-28-32-17-9-4-10-18-32)36(45-26-30-13-5-2-6-14-30)25-44(29)24-33-21-22-43(23-33)34-19-11-12-20-35(34)48-39(40,41)42/h2-20,29,33,36-38H,21-28H2,1H3/t29-,33+,36+,37-,38-/m1/s1 |
| InChIKey | HGMBRZPJIBPNTR-UDCMDSRNSA-N |
| XLogP | 7.87 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.78 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |