C18H25F3N2O5 — CID 157039844
(2R,3R,4R,5S)-2-(hydroxymethyl)-1-[[(3R)-1-[2-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]methyl]piperidine-3,4,5-triol (PubChem CID 157039844) has the molecular formula C18H25F3N2O5 and a molecular weight of 406.40 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[[(3R)-1-[2-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]methyl]piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[[(3R)-1-[2-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]methyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 157039844 |
| Molecular Formula | C18H25F3N2O5 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[[(3R)-1-[2-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]methyl]piperidine-3,4,5-triol |
| SMILES | OC[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)CN1C[C@H]1CCN(c2ccccc2OC(F)(F)F)C1 |
| InChI | InChI=1S/C18H25F3N2O5/c19-18(20,21)28-15-4-2-1-3-12(15)22-6-5-11(7-22)8-23-9-14(25)17(27)16(26)13(23)10-24/h1-4,11,13-14,16-17,24-27H,5-10H2/t11-,13+,14-,16+,17+/m0/s1 |
| InChIKey | ISVLEDZTQGWECB-OPSGJAGASA-N |
| XLogP | 0.17 |
| TPSA | 96.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |