C17H26F3NO — CID 176552586
ethane;4-propan-2-yl-1-[2-(trifluoromethoxy)phenyl]piperidine (PubChem CID 176552586) has the molecular formula C17H26F3NO and a molecular weight of 317.40 g/mol. Its IUPAC name is ethane;4-propan-2-yl-1-[2-(trifluoromethoxy)phenyl]piperidine.
| Compound Name | ethane;4-propan-2-yl-1-[2-(trifluoromethoxy)phenyl]piperidine |
|---|---|
| PubChem CID | 176552586 |
| Molecular Formula | C17H26F3NO |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | ethane;4-propan-2-yl-1-[2-(trifluoromethoxy)phenyl]piperidine |
| SMILES | CC.CC(C)C1CCN(c2ccccc2OC(F)(F)F)CC1 |
| InChI | InChI=1S/C15H20F3NO.C2H6/c1-11(2)12-7-9-19(10-8-12)13-5-3-4-6-14(13)20-15(16,17)18;1-2/h3-6,11-12H,7-10H2,1-2H3;1-2H3 |
| InChIKey | BUAZPNXREOBBNK-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |