About 1-methylpiperidin-4-ol;1-[2-(trifluoromethoxy)phenyl]pyrrolidine
1-methylpiperidin-4-ol;1-[2-(trifluoromethoxy)phenyl]pyrrolidine (PubChem CID 157039254) has the molecular formula C17H25F3N2O2
and a molecular weight of 346.39 g/mol. Its IUPAC name is 1-methylpiperidin-4-ol;1-[2-(trifluoromethoxy)phenyl]pyrrolidine.
Molecular Properties
| Compound Name | 1-methylpiperidin-4-ol;1-[2-(trifluoromethoxy)phenyl]pyrrolidine |
| PubChem CID | 157039254 |
| Molecular Formula | C17H25F3N2O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 1-methylpiperidin-4-ol;1-[2-(trifluoromethoxy)phenyl]pyrrolidine |
| SMILES | CN1CCC(O)CC1.FC(F)(F)Oc1ccccc1N1CCCC1 |
| InChI | InChI=1S/C11H12F3NO.C6H13NO/c12-11(13,14)16-10-6-2-1-5-9(10)15-7-3-4-8-15;1-7-4-2-6(8)3-5-7/h1-2,5-6H,3-4,7-8H2;6,8H,2-5H2,1H3 |
| InChIKey | IKDCEMUPGYHFBV-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methylpiperidin-4-ol;1-[2-(trifluoromethoxy)phenyl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpiperidin-4-ol;1-[2-(trifluoromethoxy)phenyl]pyrrolidine?
The IUPAC name of 1-methylpiperidin-4-ol;1-[2-(trifluoromethoxy)phenyl]pyrrolidine (CID 157039254) is 1-methylpiperidin-4-ol;1-[2-(trifluoromethoxy)phenyl]pyrrolidine.
What is the SMILES notation for 1-methylpiperidin-4-ol;1-[2-(trifluoromethoxy)phenyl]pyrrolidine?
The canonical SMILES for 1-methylpiperidin-4-ol;1-[2-(trifluoromethoxy)phenyl]pyrrolidine is CN1CCC(O)CC1.FC(F)(F)Oc1ccccc1N1CCCC1.
What is the InChIKey of 1-methylpiperidin-4-ol;1-[2-(trifluoromethoxy)phenyl]pyrrolidine?
The InChIKey is IKDCEMUPGYHFBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F3NO.C6H13NO/c12-11(13,14)16-10-6-2-1-5-9(10)15-7-3-4-8-15;1-7-4-2-6(8)3-5-7/h1-2,5-6H,3-4,7-8H2;6,8H,2-5H2,1H3.
What are the key properties of 1-methylpiperidin-4-ol;1-[2-(trifluoromethoxy)phenyl]pyrrolidine?
1-methylpiperidin-4-ol;1-[2-(trifluoromethoxy)phenyl]pyrrolidine has a molecular weight of 346.39 g/mol, XLogP of 3.26, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpiperidin-4-ol;1-[2-(trifluoromethoxy)phenyl]pyrrolidine is sourced from PubChem (CID 157039254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).