C17H25F3N2O2 — CID 157039254
1-methylpiperidin-4-ol;1-[2-(trifluoromethoxy)phenyl]pyrrolidine (PubChem CID 157039254) has the molecular formula C17H25F3N2O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is 1-methylpiperidin-4-ol;1-[2-(trifluoromethoxy)phenyl]pyrrolidine.
| Compound Name | 1-methylpiperidin-4-ol;1-[2-(trifluoromethoxy)phenyl]pyrrolidine |
|---|---|
| PubChem CID | 157039254 |
| Molecular Formula | C17H25F3N2O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 1-methylpiperidin-4-ol;1-[2-(trifluoromethoxy)phenyl]pyrrolidine |
| SMILES | CN1CCC(O)CC1.FC(F)(F)Oc1ccccc1N1CCCC1 |
| InChI | InChI=1S/C11H12F3NO.C6H13NO/c12-11(13,14)16-10-6-2-1-5-9(10)15-7-3-4-8-15;1-7-4-2-6(8)3-5-7/h1-2,5-6H,3-4,7-8H2;6,8H,2-5H2,1H3 |
| InChIKey | IKDCEMUPGYHFBV-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |