C25H29F3N4O5 — CID 58751870
(2R,3R)-4-(1,3-dihydropyrrolo[3,4-c]pyridin-2-yl)-2,3-dihydroxy-4-oxo-N-[(1R)-1-[1-[2-(trifluoromethoxy)phenyl]piperidin-4-yl]ethyl]butanamide (PubChem CID 58751870) has the molecular formula C25H29F3N4O5 and a molecular weight of 522.52 g/mol. Its IUPAC name is (2R,3R)-4-(1,3-dihydropyrrolo[3,4-c]pyridin-2-yl)-2,3-dihydroxy-4-oxo-N-[(1R)-1-[1-[2-(trifluoromethoxy)phenyl]piperidin-4-yl]ethyl]butanamide.
| Compound Name | (2R,3R)-4-(1,3-dihydropyrrolo[3,4-c]pyridin-2-yl)-2,3-dihydroxy-4-oxo-N-[(1R)-1-[1-[2-(trifluoromethoxy)phenyl]piperidin-4-yl]ethyl]butanamide |
|---|---|
| PubChem CID | 58751870 |
| Molecular Formula | C25H29F3N4O5 |
| Molecular Weight | 522.52 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | (2R,3R)-4-(1,3-dihydropyrrolo[3,4-c]pyridin-2-yl)-2,3-dihydroxy-4-oxo-N-[(1R)-1-[1-[2-(trifluoromethoxy)phenyl]piperidin-4-yl]ethyl]butanamide |
| SMILES | C[C@@H](NC(=O)[C@H](O)[C@@H](O)C(=O)N1Cc2ccncc2C1)C1CCN(c2ccccc2OC(F)(F)F)CC1 |
| InChI | InChI=1S/C25H29F3N4O5/c1-15(16-7-10-31(11-8-16)19-4-2-3-5-20(19)37-25(26,27)28)30-23(35)21(33)22(34)24(36)32-13-17-6-9-29-12-18(17)14-32/h2-6,9,12,15-16,21-22,33-34H,7-8,10-11,13-14H2,1H3,(H,30,35)/t15-,21-,22-/m1/s1 |
| InChIKey | ASAITCRHQAOTME-UJUVCNOISA-N |
| XLogP | 1.97 |
| TPSA | 115.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.52 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |