C19H25F3N2O5 — CID 157039632
[4-(trifluoromethyl)phenyl]-[(3R)-3-[[(2R,3R,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]methyl]pyrrolidin-1-yl]methanone (PubChem CID 157039632) has the molecular formula C19H25F3N2O5 and a molecular weight of 418.41 g/mol. Its IUPAC name is [4-(trifluoromethyl)phenyl]-[(3R)-3-[[(2R,3R,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]methyl]pyrrolidin-1-yl]methanone.
| Compound Name | [4-(trifluoromethyl)phenyl]-[(3R)-3-[[(2R,3R,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]methyl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 157039632 |
| Molecular Formula | C19H25F3N2O5 |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | [4-(trifluoromethyl)phenyl]-[(3R)-3-[[(2R,3R,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]methyl]pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1ccc(C(F)(F)F)cc1)N1CC[C@H](CN2C[C@H](O)[C@@H](O)[C@H](O)[C@H]2CO)C1 |
| InChI | InChI=1S/C19H25F3N2O5/c20-19(21,22)13-3-1-12(2-4-13)18(29)23-6-5-11(7-23)8-24-9-15(26)17(28)16(27)14(24)10-25/h1-4,11,14-17,25-28H,5-10H2/t11-,14+,15-,16+,17+/m0/s1 |
| InChIKey | JRAQTJNDAIOONQ-FEMNKSEZSA-N |
| XLogP | -0.07 |
| TPSA | 104.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |