C20H27F3N2O4 — CID 155286438
[3-(trifluoromethyl)phenyl]-[4-[[(2R,3R,4R,5S)-3,4,5-trihydroxy-2-methylpiperidin-1-yl]methyl]piperidin-1-yl]methanone (PubChem CID 155286438) has the molecular formula C20H27F3N2O4 and a molecular weight of 416.44 g/mol. Its IUPAC name is [3-(trifluoromethyl)phenyl]-[4-[[(2R,3R,4R,5S)-3,4,5-trihydroxy-2-methylpiperidin-1-yl]methyl]piperidin-1-yl]methanone.
| Compound Name | [3-(trifluoromethyl)phenyl]-[4-[[(2R,3R,4R,5S)-3,4,5-trihydroxy-2-methylpiperidin-1-yl]methyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 155286438 |
| Molecular Formula | C20H27F3N2O4 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | [3-(trifluoromethyl)phenyl]-[4-[[(2R,3R,4R,5S)-3,4,5-trihydroxy-2-methylpiperidin-1-yl]methyl]piperidin-1-yl]methanone |
| SMILES | C[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)CN1CC1CCN(C(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C20H27F3N2O4/c1-12-17(27)18(28)16(26)11-25(12)10-13-5-7-24(8-6-13)19(29)14-3-2-4-15(9-14)20(21,22)23/h2-4,9,12-13,16-18,26-28H,5-8,10-11H2,1H3/t12-,16+,17-,18-/m1/s1 |
| InChIKey | FZFGCGDTEZMAFO-QRVDHSFSSA-N |
| XLogP | 1.34 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |