C15H24N2O4S — CID 157039631
(2R,3R,4R,5S)-2-(hydroxymethyl)-1-[[(3R)-1-thiophen-3-ylpyrrolidin-3-yl]methyl]piperidine-3,4,5-triol (PubChem CID 157039631) has the molecular formula C15H24N2O4S and a molecular weight of 328.43 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[[(3R)-1-thiophen-3-ylpyrrolidin-3-yl]methyl]piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[[(3R)-1-thiophen-3-ylpyrrolidin-3-yl]methyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 157039631 |
| Molecular Formula | C15H24N2O4S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[[(3R)-1-thiophen-3-ylpyrrolidin-3-yl]methyl]piperidine-3,4,5-triol |
| SMILES | OC[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)CN1C[C@H]1CCN(c2ccsc2)C1 |
| InChI | InChI=1S/C15H24N2O4S/c18-8-12-14(20)15(21)13(19)7-17(12)6-10-1-3-16(5-10)11-2-4-22-9-11/h2,4,9-10,12-15,18-21H,1,3,5-8H2/t10-,12+,13-,14+,15+/m0/s1 |
| InChIKey | GGIZFRMZXKRKHT-XFZHLKPQSA-N |
| XLogP | -0.67 |
| TPSA | 87.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |