C18H31N3O4S — CID 157039464
(2S,3R,4R,5S)-2-(hydroxymethyl)-1-[[(3R)-1-(5-propan-2-yl-1,3-thiazol-2-yl)piperidin-3-yl]methyl]piperidine-3,4,5-triol (PubChem CID 157039464) has the molecular formula C18H31N3O4S and a molecular weight of 385.53 g/mol. Its IUPAC name is (2S,3R,4R,5S)-2-(hydroxymethyl)-1-[[(3R)-1-(5-propan-2-yl-1,3-thiazol-2-yl)piperidin-3-yl]methyl]piperidine-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S)-2-(hydroxymethyl)-1-[[(3R)-1-(5-propan-2-yl-1,3-thiazol-2-yl)piperidin-3-yl]methyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 157039464 |
| Molecular Formula | C18H31N3O4S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | (2S,3R,4R,5S)-2-(hydroxymethyl)-1-[[(3R)-1-(5-propan-2-yl-1,3-thiazol-2-yl)piperidin-3-yl]methyl]piperidine-3,4,5-triol |
| SMILES | CC(C)c1cnc(N2CCC[C@H](CN3C[C@H](O)[C@@H](O)[C@H](O)[C@@H]3CO)C2)s1 |
| InChI | InChI=1S/C18H31N3O4S/c1-11(2)15-6-19-18(26-15)20-5-3-4-12(7-20)8-21-9-14(23)17(25)16(24)13(21)10-22/h6,11-14,16-17,22-25H,3-5,7-10H2,1-2H3/t12-,13-,14-,16+,17+/m0/s1 |
| InChIKey | DIBNKGKXGVRVFO-WLRQEKSISA-N |
| XLogP | 0.24 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |