C19H27N3O3S — CID 155302780
(2R,3R,4R,5S)-1-[[(3R)-1-(1,3-benzothiazol-4-yl)piperidin-3-yl]methyl]-2-methylpiperidine-3,4,5-triol (PubChem CID 155302780) has the molecular formula C19H27N3O3S and a molecular weight of 377.51 g/mol. Its IUPAC name is (2R,3R,4R,5S)-1-[[(3R)-1-(1,3-benzothiazol-4-yl)piperidin-3-yl]methyl]-2-methylpiperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-1-[[(3R)-1-(1,3-benzothiazol-4-yl)piperidin-3-yl]methyl]-2-methylpiperidine-3,4,5-triol |
|---|---|
| PubChem CID | 155302780 |
| Molecular Formula | C19H27N3O3S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | (2R,3R,4R,5S)-1-[[(3R)-1-(1,3-benzothiazol-4-yl)piperidin-3-yl]methyl]-2-methylpiperidine-3,4,5-triol |
| SMILES | C[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)CN1C[C@H]1CCCN(c2cccc3scnc23)C1 |
| InChI | InChI=1S/C19H27N3O3S/c1-12-18(24)19(25)15(23)10-22(12)9-13-4-3-7-21(8-13)14-5-2-6-16-17(14)20-11-26-16/h2,5-6,11-13,15,18-19,23-25H,3-4,7-10H2,1H3/t12-,13+,15+,18-,19-/m1/s1 |
| InChIKey | XARHUZGJIPQUAR-JNGUWMMZSA-N |
| XLogP | 1.30 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |