C17H27N3O3 — CID 165109184
(2R,3R,4R,5S)-2-methyl-1-[[(3S)-1-(4-methyl-3-pyridinyl)pyrrolidin-3-yl]methyl]piperidine-3,4,5-triol (PubChem CID 165109184) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-methyl-1-[[(3S)-1-(4-methyl-3-pyridinyl)pyrrolidin-3-yl]methyl]piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-2-methyl-1-[[(3S)-1-(4-methyl-3-pyridinyl)pyrrolidin-3-yl]methyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 165109184 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | (2R,3R,4R,5S)-2-methyl-1-[[(3S)-1-(4-methyl-3-pyridinyl)pyrrolidin-3-yl]methyl]piperidine-3,4,5-triol |
| SMILES | Cc1ccncc1N1CC[C@@H](CN2C[C@H](O)[C@@H](O)[C@H](O)[C@H]2C)C1 |
| InChI | InChI=1S/C17H27N3O3/c1-11-3-5-18-7-14(11)19-6-4-13(8-19)9-20-10-15(21)17(23)16(22)12(20)2/h3,5,7,12-13,15-17,21-23H,4,6,8-10H2,1-2H3/t12-,13-,15+,16-,17-/m1/s1 |
| InChIKey | ZQWLNPZRFPYSPB-MAURAIGZSA-N |
| XLogP | 0.00 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |