C16H24F3N3O4S — CID 157039629
(2S,3R,4R,5S)-2-(hydroxymethyl)-1-[[(3S)-1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperidin-3-yl]methyl]piperidine-3,4,5-triol (PubChem CID 157039629) has the molecular formula C16H24F3N3O4S and a molecular weight of 411.45 g/mol. Its IUPAC name is (2S,3R,4R,5S)-2-(hydroxymethyl)-1-[[(3S)-1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperidin-3-yl]methyl]piperidine-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S)-2-(hydroxymethyl)-1-[[(3S)-1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperidin-3-yl]methyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 157039629 |
| Molecular Formula | C16H24F3N3O4S |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | (2S,3R,4R,5S)-2-(hydroxymethyl)-1-[[(3S)-1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperidin-3-yl]methyl]piperidine-3,4,5-triol |
| SMILES | OC[C@H]1[C@@H](O)[C@H](O)[C@@H](O)CN1C[C@@H]1CCCN(c2nc(C(F)(F)F)cs2)C1 |
| InChI | InChI=1S/C16H24F3N3O4S/c17-16(18,19)12-8-27-15(20-12)21-3-1-2-9(4-21)5-22-6-11(24)14(26)13(25)10(22)7-23/h8-11,13-14,23-26H,1-7H2/t9-,10+,11+,13-,14-/m1/s1 |
| InChIKey | XYQVCGGAXUAZEP-CAFXUDQZSA-N |
| XLogP | 0.14 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |