About 1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperidin-4-amine
1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperidin-4-amine (PubChem CID 69066579) has the molecular formula C9H12F3N3S
and a molecular weight of 251.28 g/mol. Its IUPAC name is 1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperidin-4-amine.
Molecular Properties
| Compound Name | 1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperidin-4-amine |
| PubChem CID | 69066579 |
| Molecular Formula | C9H12F3N3S |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperidin-4-amine |
| SMILES | NC1CCN(c2nc(C(F)(F)F)cs2)CC1 |
| InChI | InChI=1S/C9H12F3N3S/c10-9(11,12)7-5-16-8(14-7)15-3-1-6(13)2-4-15/h5-6H,1-4,13H2 |
| InChIKey | OKBLWEOWKGNEAN-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperidin-4-amine?
The IUPAC name of 1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperidin-4-amine (CID 69066579) is 1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperidin-4-amine.
What is the SMILES notation for 1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperidin-4-amine?
The canonical SMILES for 1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperidin-4-amine is NC1CCN(c2nc(C(F)(F)F)cs2)CC1.
What is the InChIKey of 1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperidin-4-amine?
The InChIKey is OKBLWEOWKGNEAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F3N3S/c10-9(11,12)7-5-16-8(14-7)15-3-1-6(13)2-4-15/h5-6H,1-4,13H2.
What are the key properties of 1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperidin-4-amine?
1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperidin-4-amine has a molecular weight of 251.28 g/mol, XLogP of 2.09, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperidin-4-amine is sourced from PubChem (CID 69066579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).