C18H24F3N3OS — CID 172880827
1-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-2-[1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperidin-4-yl]ethanone (PubChem CID 172880827) has the molecular formula C18H24F3N3OS and a molecular weight of 387.47 g/mol. Its IUPAC name is 1-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-2-[1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperidin-4-yl]ethanone.
| Compound Name | 1-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-2-[1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperidin-4-yl]ethanone |
|---|---|
| PubChem CID | 172880827 |
| Molecular Formula | C18H24F3N3OS |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 1-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-2-[1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperidin-4-yl]ethanone |
| SMILES | O=C(CC1CCN(c2nc(C(F)(F)F)cs2)CC1)N1CC2CCCC2C1 |
| InChI | InChI=1S/C18H24F3N3OS/c19-18(20,21)15-11-26-17(22-15)23-6-4-12(5-7-23)8-16(25)24-9-13-2-1-3-14(13)10-24/h11-14H,1-10H2 |
| InChIKey | GNNSMDZBONZIMK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |