C19H35N3O4S — CID 157039898
N-cyclohexyl-4-[[(2S,3R,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]methyl]piperidine-1-carbothioamide (PubChem CID 157039898) has the molecular formula C19H35N3O4S and a molecular weight of 401.57 g/mol. Its IUPAC name is N-cyclohexyl-4-[[(2S,3R,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]methyl]piperidine-1-carbothioamide.
| Compound Name | N-cyclohexyl-4-[[(2S,3R,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]methyl]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 157039898 |
| Molecular Formula | C19H35N3O4S |
| Molecular Weight | 401.57 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | N-cyclohexyl-4-[[(2S,3R,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]methyl]piperidine-1-carbothioamide |
| SMILES | OC[C@H]1[C@@H](O)[C@H](O)[C@@H](O)CN1CC1CCN(C(=S)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C19H35N3O4S/c23-12-15-17(25)18(26)16(24)11-22(15)10-13-6-8-21(9-7-13)19(27)20-14-4-2-1-3-5-14/h13-18,23-26H,1-12H2,(H,20,27)/t15-,16-,17+,18+/m0/s1 |
| InChIKey | OISCYMAFUJPPLE-WNRNVDISSA-N |
| XLogP | -0.34 |
| TPSA | 99.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.57 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|