C18H33N3O3S — CID 166834272
N-cyclohexyl-4-[[(3S,5R)-3,4,5-trihydroxypiperidin-1-yl]methyl]piperidine-1-carbothioamide (PubChem CID 166834272) has the molecular formula C18H33N3O3S and a molecular weight of 371.55 g/mol. Its IUPAC name is N-cyclohexyl-4-[[(3S,5R)-3,4,5-trihydroxypiperidin-1-yl]methyl]piperidine-1-carbothioamide.
| Compound Name | N-cyclohexyl-4-[[(3S,5R)-3,4,5-trihydroxypiperidin-1-yl]methyl]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 166834272 |
| Molecular Formula | C18H33N3O3S |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | N-cyclohexyl-4-[[(3S,5R)-3,4,5-trihydroxypiperidin-1-yl]methyl]piperidine-1-carbothioamide |
| SMILES | OC1[C@H](O)CN(CC2CCN(C(=S)NC3CCCCC3)CC2)C[C@@H]1O |
| InChI | InChI=1S/C18H33N3O3S/c22-15-11-20(12-16(23)17(15)24)10-13-6-8-21(9-7-13)18(25)19-14-4-2-1-3-5-14/h13-17,22-24H,1-12H2,(H,19,25)/t15-,16+,17? |
| InChIKey | KHKMJKAWBPJUMJ-SJPCQFCGSA-N |
| XLogP | 0.30 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|