C14H26N2S — CID 2457098
(3R,5S)-N-cyclohexyl-3,5-dimethylpiperidine-1-carbothioamide (PubChem CID 2457098) has the molecular formula C14H26N2S and a molecular weight of 254.44 g/mol. Its IUPAC name is (3R,5S)-N-cyclohexyl-3,5-dimethylpiperidine-1-carbothioamide.
| Compound Name | (3R,5S)-N-cyclohexyl-3,5-dimethylpiperidine-1-carbothioamide |
|---|---|
| PubChem CID | 2457098 |
| Molecular Formula | C14H26N2S |
| Molecular Weight | 254.44 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | (3R,5S)-N-cyclohexyl-3,5-dimethylpiperidine-1-carbothioamide |
| SMILES | C[C@@H]1C[C@H](C)CN(C(=S)NC2CCCCC2)C1 |
| InChI | InChI=1S/C14H26N2S/c1-11-8-12(2)10-16(9-11)14(17)15-13-6-4-3-5-7-13/h11-13H,3-10H2,1-2H3,(H,15,17)/t11-,12+ |
| InChIKey | QLNVTSLHVPXNKC-TXEJJXNPSA-N |
| XLogP | 3.17 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|