C11H20N2S — CID 51529104
(3R,5S)-N-cyclopropyl-3,5-dimethylpiperidine-1-carbothioamide (PubChem CID 51529104) has the molecular formula C11H20N2S and a molecular weight of 212.36 g/mol. Its IUPAC name is (3R,5S)-N-cyclopropyl-3,5-dimethylpiperidine-1-carbothioamide.
| Compound Name | (3R,5S)-N-cyclopropyl-3,5-dimethylpiperidine-1-carbothioamide |
|---|---|
| PubChem CID | 51529104 |
| Molecular Formula | C11H20N2S |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | (3R,5S)-N-cyclopropyl-3,5-dimethylpiperidine-1-carbothioamide |
| SMILES | C[C@@H]1C[C@H](C)CN(C(=S)NC2CC2)C1 |
| InChI | InChI=1S/C11H20N2S/c1-8-5-9(2)7-13(6-8)11(14)12-10-3-4-10/h8-10H,3-7H2,1-2H3,(H,12,14)/t8-,9+ |
| InChIKey | ZDPKKDDUHJJTQO-DTORHVGOSA-N |
| XLogP | 2.00 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|