C44H54N2O6 — CID 157039774
tert-butyl (3S)-3-[[(2S,3R,4R,5S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)piperidin-1-yl]methyl]pyrrolidine-1-carboxylate (PubChem CID 157039774) has the molecular formula C44H54N2O6 and a molecular weight of 706.92 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[(2S,3R,4R,5S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)piperidin-1-yl]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[[(2S,3R,4R,5S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)piperidin-1-yl]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 157039774 |
| Molecular Formula | C44H54N2O6 |
| Molecular Weight | 706.92 g/mol |
| Exact Mass | 706.40 |
| IUPAC Name | tert-butyl (3S)-3-[[(2S,3R,4R,5S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)piperidin-1-yl]methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](CN2C[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H]2COCc2ccccc2)C1 |
| InChI | InChI=1S/C44H54N2O6/c1-44(2,3)52-43(47)45-25-24-38(26-45)27-46-28-40(49-30-35-18-10-5-11-19-35)42(51-32-37-22-14-7-15-23-37)41(50-31-36-20-12-6-13-21-36)39(46)33-48-29-34-16-8-4-9-17-34/h4-23,38-42H,24-33H2,1-3H3/t38-,39+,40+,41-,42-/m1/s1 |
| InChIKey | QQPIMBWNJHZCGS-ZGQNSXDSSA-N |
| XLogP | 7.90 |
| TPSA | 69.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.92 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |