C34H41F2NO3 — CID 175865933
(3R,5S)-1-[[4-(difluoromethyl)cyclohexyl]methyl]-3,4,5-tris(phenylmethoxy)piperidine (PubChem CID 175865933) has the molecular formula C34H41F2NO3 and a molecular weight of 549.70 g/mol. Its IUPAC name is (3R,5S)-1-[[4-(difluoromethyl)cyclohexyl]methyl]-3,4,5-tris(phenylmethoxy)piperidine.
| Compound Name | (3R,5S)-1-[[4-(difluoromethyl)cyclohexyl]methyl]-3,4,5-tris(phenylmethoxy)piperidine |
|---|---|
| PubChem CID | 175865933 |
| Molecular Formula | C34H41F2NO3 |
| Molecular Weight | 549.70 g/mol |
| Exact Mass | 549.31 |
| IUPAC Name | (3R,5S)-1-[[4-(difluoromethyl)cyclohexyl]methyl]-3,4,5-tris(phenylmethoxy)piperidine |
| SMILES | FC(F)C1CCC(CN2C[C@H](OCc3ccccc3)C(OCc3ccccc3)[C@H](OCc3ccccc3)C2)CC1 |
| InChI | InChI=1S/C34H41F2NO3/c35-34(36)30-18-16-26(17-19-30)20-37-21-31(38-23-27-10-4-1-5-11-27)33(40-25-29-14-8-3-9-15-29)32(22-37)39-24-28-12-6-2-7-13-28/h1-15,26,30-34H,16-25H2/t26?,30?,31-,32+,33? |
| InChIKey | RRWZVWAMJFEFFH-VOHVBWPCSA-N |
| XLogP | 7.13 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.70 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |