C34H34ClF2NO3 — CID 175865927
(3R,5S)-1-[2-(3-chloro-2,6-difluorophenyl)ethyl]-3,4,5-tris(phenylmethoxy)piperidine (PubChem CID 175865927) has the molecular formula C34H34ClF2NO3 and a molecular weight of 578.10 g/mol. Its IUPAC name is (3R,5S)-1-[2-(3-chloro-2,6-difluorophenyl)ethyl]-3,4,5-tris(phenylmethoxy)piperidine.
| Compound Name | (3R,5S)-1-[2-(3-chloro-2,6-difluorophenyl)ethyl]-3,4,5-tris(phenylmethoxy)piperidine |
|---|---|
| PubChem CID | 175865927 |
| Molecular Formula | C34H34ClF2NO3 |
| Molecular Weight | 578.10 g/mol |
| Exact Mass | 577.22 |
| IUPAC Name | (3R,5S)-1-[2-(3-chloro-2,6-difluorophenyl)ethyl]-3,4,5-tris(phenylmethoxy)piperidine |
| SMILES | Fc1ccc(Cl)c(F)c1CCN1C[C@H](OCc2ccccc2)C(OCc2ccccc2)[C@H](OCc2ccccc2)C1 |
| InChI | InChI=1S/C34H34ClF2NO3/c35-29-16-17-30(36)28(33(29)37)18-19-38-20-31(39-22-25-10-4-1-5-11-25)34(41-24-27-14-8-3-9-15-27)32(21-38)40-23-26-12-6-2-7-13-26/h1-17,31-32,34H,18-24H2/t31-,32+,34? |
| InChIKey | JZDLHUDOPDHPBH-AGUBCAFJSA-N |
| XLogP | 7.23 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.10 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|