C21H25NO4 — CID 11566573
(1S,2R,6S,7S,8S)-6,7-bis(phenylmethoxy)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2-diol (PubChem CID 11566573) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is (1S,2R,6S,7S,8S)-6,7-bis(phenylmethoxy)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2-diol.
| Compound Name | (1S,2R,6S,7S,8S)-6,7-bis(phenylmethoxy)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2-diol |
|---|---|
| PubChem CID | 11566573 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | (1S,2R,6S,7S,8S)-6,7-bis(phenylmethoxy)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2-diol |
| SMILES | O[C@H]1[C@H]2[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)CN2C[C@H]1O |
| InChI | InChI=1S/C21H25NO4/c23-17-11-22-12-18(25-13-15-7-3-1-4-8-15)21(19(22)20(17)24)26-14-16-9-5-2-6-10-16/h1-10,17-21,23-24H,11-14H2/t17-,18+,19+,20-,21-/m1/s1 |
| InChIKey | FLSAHPDOYGHJRL-XDWAVFMPSA-N |
| XLogP | 1.58 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |