C22H27NO5 — CID 11303686
(1S,2S,5R,6R,7R,8R)-5-(hydroxymethyl)-6,7-bis(phenylmethoxy)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2-diol (PubChem CID 11303686) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is (1S,2S,5R,6R,7R,8R)-5-(hydroxymethyl)-6,7-bis(phenylmethoxy)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2-diol.
| Compound Name | (1S,2S,5R,6R,7R,8R)-5-(hydroxymethyl)-6,7-bis(phenylmethoxy)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2-diol |
|---|---|
| PubChem CID | 11303686 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | (1S,2S,5R,6R,7R,8R)-5-(hydroxymethyl)-6,7-bis(phenylmethoxy)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2-diol |
| SMILES | OC[C@@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]2[C@H](O)[C@@H](O)CN21 |
| InChI | InChI=1S/C22H27NO5/c24-12-17-21(27-13-15-7-3-1-4-8-15)22(19-20(26)18(25)11-23(17)19)28-14-16-9-5-2-6-10-16/h1-10,17-22,24-26H,11-14H2/t17-,18+,19-,20-,21-,22-/m1/s1 |
| InChIKey | DXUUDIDMBICQMP-DRGMGAIOSA-N |
| XLogP | 0.94 |
| TPSA | 82.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |