C23H29NO5 — CID 56930085
(1S,2S,3S,5R,6R,7R,8R)-5-(hydroxymethyl)-3-methyl-6,7-bis(phenylmethoxy)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2-diol (PubChem CID 56930085) has the molecular formula C23H29NO5 and a molecular weight of 399.49 g/mol. Its IUPAC name is (1S,2S,3S,5R,6R,7R,8R)-5-(hydroxymethyl)-3-methyl-6,7-bis(phenylmethoxy)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2-diol.
| Compound Name | (1S,2S,3S,5R,6R,7R,8R)-5-(hydroxymethyl)-3-methyl-6,7-bis(phenylmethoxy)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2-diol |
|---|---|
| PubChem CID | 56930085 |
| Molecular Formula | C23H29NO5 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | (1S,2S,3S,5R,6R,7R,8R)-5-(hydroxymethyl)-3-methyl-6,7-bis(phenylmethoxy)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2-diol |
| SMILES | C[C@H]1[C@H](O)[C@@H](O)[C@@H]2[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H](CO)N21 |
| InChI | InChI=1S/C23H29NO5/c1-15-20(26)21(27)19-23(29-14-17-10-6-3-7-11-17)22(18(12-25)24(15)19)28-13-16-8-4-2-5-9-16/h2-11,15,18-23,25-27H,12-14H2,1H3/t15-,18+,19+,20-,21-,22+,23+/m0/s1 |
| InChIKey | OICFRZISJLKZCQ-HNVWNQPRSA-N |
| XLogP | 1.33 |
| TPSA | 82.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |