C30H35NO4 — CID 15287282
(1R,7R,8R,9R,9aS)-7,8,9-tris(phenylmethoxy)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ol (PubChem CID 15287282) has the molecular formula C30H35NO4 and a molecular weight of 473.61 g/mol. Its IUPAC name is (1R,7R,8R,9R,9aS)-7,8,9-tris(phenylmethoxy)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ol.
| Compound Name | (1R,7R,8R,9R,9aS)-7,8,9-tris(phenylmethoxy)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ol |
|---|---|
| PubChem CID | 15287282 |
| Molecular Formula | C30H35NO4 |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | (1R,7R,8R,9R,9aS)-7,8,9-tris(phenylmethoxy)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ol |
| SMILES | O[C@@H]1CCCN2CC(OCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]12 |
| InChI | InChI=1S/C30H35NO4/c32-26-17-10-18-31-19-27(33-20-23-11-4-1-5-12-23)29(34-21-24-13-6-2-7-14-24)30(28(26)31)35-22-25-15-8-3-9-16-25/h1-9,11-16,26-30,32H,10,17-22H2/t26-,27?,28+,29-,30-/m1/s1 |
| InChIKey | MSZRZNSHPDOYBA-GGOUHMFKSA-N |
| XLogP | 4.58 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |