C18H27NO2 — CID 56648989
(3R,4S)-1-cyclohexyl-3-phenylmethoxypiperidin-4-ol (PubChem CID 56648989) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is (3R,4S)-1-cyclohexyl-3-phenylmethoxypiperidin-4-ol.
| Compound Name | (3R,4S)-1-cyclohexyl-3-phenylmethoxypiperidin-4-ol |
|---|---|
| PubChem CID | 56648989 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | (3R,4S)-1-cyclohexyl-3-phenylmethoxypiperidin-4-ol |
| SMILES | O[C@H]1CCN(C2CCCCC2)C[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C18H27NO2/c20-17-11-12-19(16-9-5-2-6-10-16)13-18(17)21-14-15-7-3-1-4-8-15/h1,3-4,7-8,16-18,20H,2,5-6,9-14H2/t17-,18+/m0/s1 |
| InChIKey | DKPJIZSHLGOELW-ZWKOTPCHSA-N |
| XLogP | 2.97 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |