C12H18NO+ — CID 11863648
[(1R,2R)-2-phenylmethoxycyclopentyl]azanium (PubChem CID 11863648) has the molecular formula C12H18NO+ and a molecular weight of 192.28 g/mol. Its IUPAC name is [(1R,2R)-2-phenylmethoxycyclopentyl]azanium.
| Compound Name | [(1R,2R)-2-phenylmethoxycyclopentyl]azanium |
|---|---|
| PubChem CID | 11863648 |
| Molecular Formula | C12H18NO+ |
| Molecular Weight | 192.28 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | [(1R,2R)-2-phenylmethoxycyclopentyl]azanium |
| SMILES | [NH3+][C@@H]1CCC[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C12H17NO/c13-11-7-4-8-12(11)14-9-10-5-2-1-3-6-10/h1-3,5-6,11-12H,4,7-9,13H2/p+1/t11-,12-/m1/s1 |
| InChIKey | JIMSXLUBRRQALI-VXGBXAGGSA-O |
| XLogP | 1.37 |
| TPSA | 36.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.28 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |