C13H15NO2 — CID 11863571
[(1S,2S)-2-isocyanatocyclopentyl]oxymethylbenzene (PubChem CID 11863571) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is [(1S,2S)-2-isocyanatocyclopentyl]oxymethylbenzene.
| Compound Name | [(1S,2S)-2-isocyanatocyclopentyl]oxymethylbenzene |
|---|---|
| PubChem CID | 11863571 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | [(1S,2S)-2-isocyanatocyclopentyl]oxymethylbenzene |
| SMILES | O=C=N[C@H]1CCC[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C13H15NO2/c15-10-14-12-7-4-8-13(12)16-9-11-5-2-1-3-6-11/h1-3,5-6,12-13H,4,7-9H2/t12-,13-/m0/s1 |
| InChIKey | OBCLNTYESQZKFV-STQMWFEESA-N |
| XLogP | 2.46 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|