C14H18O3 — CID 115040131
2-(2-phenylmethoxycyclopentyl)acetic acid (PubChem CID 115040131) has the molecular formula C14H18O3 and a molecular weight of 234.30 g/mol. Its IUPAC name is 2-(2-phenylmethoxycyclopentyl)acetic acid.
| Compound Name | 2-(2-phenylmethoxycyclopentyl)acetic acid |
|---|---|
| PubChem CID | 115040131 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 2-(2-phenylmethoxycyclopentyl)acetic acid |
| SMILES | O=C(O)CC1CCCC1OCc1ccccc1 |
| InChI | InChI=1S/C14H18O3/c15-14(16)9-12-7-4-8-13(12)17-10-11-5-2-1-3-6-11/h1-3,5-6,12-13H,4,7-10H2,(H,15,16) |
| InChIKey | SQMYJMXRLFKAGE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |