C14H20N2O — CID 143473195
1-N'-[(1S,2S)-2-phenylmethoxycyclopentyl]ethene-1,1-diamine (PubChem CID 143473195) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 1-N'-[(1S,2S)-2-phenylmethoxycyclopentyl]ethene-1,1-diamine.
| Compound Name | 1-N'-[(1S,2S)-2-phenylmethoxycyclopentyl]ethene-1,1-diamine |
|---|---|
| PubChem CID | 143473195 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 1-N'-[(1S,2S)-2-phenylmethoxycyclopentyl]ethene-1,1-diamine |
| SMILES | C=C(N)N[C@H]1CCC[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C14H20N2O/c1-11(15)16-13-8-5-9-14(13)17-10-12-6-3-2-4-7-12/h2-4,6-7,13-14,16H,1,5,8-10,15H2/t13-,14-/m0/s1 |
| InChIKey | AXXSAHBPHPHXBJ-KBPBESRZSA-N |
| XLogP | 2.14 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |