C15H21N3O3 — CID 101365257
N-[[(1S,2S)-2-phenylmethoxycyclohexyl]carbamoylamino]formamide (PubChem CID 101365257) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is N-[[(1S,2S)-2-phenylmethoxycyclohexyl]carbamoylamino]formamide.
| Compound Name | N-[[(1S,2S)-2-phenylmethoxycyclohexyl]carbamoylamino]formamide |
|---|---|
| PubChem CID | 101365257 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | N-[[(1S,2S)-2-phenylmethoxycyclohexyl]carbamoylamino]formamide |
| SMILES | O=CNNC(=O)N[C@H]1CCCC[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C15H21N3O3/c19-11-16-18-15(20)17-13-8-4-5-9-14(13)21-10-12-6-2-1-3-7-12/h1-3,6-7,11,13-14H,4-5,8-10H2,(H,16,19)(H2,17,18,20)/t13-,14-/m0/s1 |
| InChIKey | IHLCMHQNEGISSR-KBPBESRZSA-N |
| XLogP | 1.47 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|