C19H22OSi — CID 15200792
CID 15200792 (PubChem CID 15200792) has the molecular formula C19H22OSi and a molecular weight of 294.47 g/mol.
| Compound Name | CID 15200792 |
|---|---|
| PubChem CID | 15200792 |
| Molecular Formula | C19H22OSi |
| Molecular Weight | 294.47 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | — |
| SMILES | c1ccc(CO[C@H]2CCC[C@@H]2C[Si]c2ccccc2)cc1 |
| InChI | InChI=1S/C19H22OSi/c1-3-8-16(9-4-1)14-20-19-13-7-10-17(19)15-21-18-11-5-2-6-12-18/h1-6,8-9,11-12,17,19H,7,10,13-15H2/t17-,19+/m1/s1 |
| InChIKey | YQUQLQGMDKYJBE-MJGOQNOKSA-N |
| XLogP | 3.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|