C16H24O3 — CID 122394514
[(1R,2R)-2-(2,2-dimethoxyethyl)cyclopentyl]oxymethylbenzene (PubChem CID 122394514) has the molecular formula C16H24O3 and a molecular weight of 264.37 g/mol. Its IUPAC name is [(1R,2R)-2-(2,2-dimethoxyethyl)cyclopentyl]oxymethylbenzene.
| Compound Name | [(1R,2R)-2-(2,2-dimethoxyethyl)cyclopentyl]oxymethylbenzene |
|---|---|
| PubChem CID | 122394514 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | [(1R,2R)-2-(2,2-dimethoxyethyl)cyclopentyl]oxymethylbenzene |
| SMILES | COC(C[C@H]1CCC[C@H]1OCc1ccccc1)OC |
| InChI | InChI=1S/C16H24O3/c1-17-16(18-2)11-14-9-6-10-15(14)19-12-13-7-4-3-5-8-13/h3-5,7-8,14-16H,6,9-12H2,1-2H3/t14-,15-/m1/s1 |
| InChIKey | MBVYYWGQGXFAAN-HUUCEWRRSA-N |
| XLogP | 3.38 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|