C18H26O2 — CID 6442590
(E)-5-[(1R,2S)-2-phenylmethoxycyclohexyl]pent-2-en-1-ol (PubChem CID 6442590) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is (E)-5-[(1R,2S)-2-phenylmethoxycyclohexyl]pent-2-en-1-ol.
| Compound Name | (E)-5-[(1R,2S)-2-phenylmethoxycyclohexyl]pent-2-en-1-ol |
|---|---|
| PubChem CID | 6442590 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | (E)-5-[(1R,2S)-2-phenylmethoxycyclohexyl]pent-2-en-1-ol |
| SMILES | OC/C=C/CC[C@H]1CCCC[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C18H26O2/c19-14-8-2-5-11-17-12-6-7-13-18(17)20-15-16-9-3-1-4-10-16/h1-4,8-10,17-19H,5-7,11-15H2/b8-2+/t17-,18-/m0/s1 |
| InChIKey | HPBMLHURPIZYGU-WWMFUTFBSA-N |
| XLogP | 4.09 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|