C21H32O2 — CID 122384803
cis-(1R,2S)-1-[(2S)-2-methoxy-4-methylpent-4-enyl]-2-phenylmethoxycycloheptane (PubChem CID 122384803) has the molecular formula C21H32O2 and a molecular weight of 316.48 g/mol. Its IUPAC name is cis-(1R,2S)-1-[(2S)-2-methoxy-4-methylpent-4-enyl]-2-phenylmethoxycycloheptane.
| Compound Name | cis-(1R,2S)-1-[(2S)-2-methoxy-4-methylpent-4-enyl]-2-phenylmethoxycycloheptane |
|---|---|
| PubChem CID | 122384803 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.48 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | cis-(1R,2S)-1-[(2S)-2-methoxy-4-methylpent-4-enyl]-2-phenylmethoxycycloheptane |
| SMILES | C=C(C)C[C@H](C[C@H]1CCCCC[C@@H]1OCc1ccccc1)OC |
| InChI | InChI=1S/C21H32O2/c1-17(2)14-20(22-3)15-19-12-8-5-9-13-21(19)23-16-18-10-6-4-7-11-18/h4,6-7,10-11,19-21H,1,5,8-9,12-16H2,2-3H3/t19-,20-,21+/m1/s1 |
| InChIKey | XUNYNBIHUFPWBN-NJYVYQBISA-N |
| XLogP | 5.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.48 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|