C23H32O2 — CID 142842449
cis-(1R,2S)-1-methoxy-2-phenylmethoxycycloheptane;ethylbenzene (PubChem CID 142842449) has the molecular formula C23H32O2 and a molecular weight of 340.51 g/mol. Its IUPAC name is cis-(1R,2S)-1-methoxy-2-phenylmethoxycycloheptane;ethylbenzene.
| Compound Name | cis-(1R,2S)-1-methoxy-2-phenylmethoxycycloheptane;ethylbenzene |
|---|---|
| PubChem CID | 142842449 |
| Molecular Formula | C23H32O2 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | cis-(1R,2S)-1-methoxy-2-phenylmethoxycycloheptane;ethylbenzene |
| SMILES | CCc1ccccc1.CO[C@@H]1CCCCC[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C15H22O2.C8H10/c1-16-14-10-6-3-7-11-15(14)17-12-13-8-4-2-5-9-13;1-2-8-6-4-3-5-7-8/h2,4-5,8-9,14-15H,3,6-7,10-12H2,1H3;3-7H,2H2,1H3/t14-,15+;/m1./s1 |
| InChIKey | ISGWSWURWRDASR-LIOBNPLQSA-N |
| XLogP | 5.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |