C13H17BrHgO — CID 134981077
bromo-[(1S,2S)-2-phenylmethoxycyclohexyl]mercury (PubChem CID 134981077) has the molecular formula C13H17BrHgO and a molecular weight of 469.77 g/mol. Its IUPAC name is bromo-[(1S,2S)-2-phenylmethoxycyclohexyl]mercury.
| Compound Name | bromo-[(1S,2S)-2-phenylmethoxycyclohexyl]mercury |
|---|---|
| PubChem CID | 134981077 |
| Molecular Formula | C13H17BrHgO |
| Molecular Weight | 469.77 g/mol |
| Exact Mass | 470.02 |
| IUPAC Name | bromo-[(1S,2S)-2-phenylmethoxycyclohexyl]mercury |
| SMILES | Br[Hg][C@H]1CCCC[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C13H17O.BrH.Hg/c1-3-7-12(8-4-1)11-14-13-9-5-2-6-10-13;;/h1,3-4,7-9,13H,2,5-6,10-11H2;1H;/q;;+1/p-1/t13-;;/m1../s1 |
| InChIKey | HYLVZCCWUBKPFW-FFXKMJQXSA-M |
| XLogP | 4.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.77 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|