C20H19NO3 — CID 68810098
2-[(1S,2R)-2-phenylmethoxycyclopentyl]isoindole-1,3-dione (PubChem CID 68810098) has the molecular formula C20H19NO3 and a molecular weight of 321.38 g/mol. Its IUPAC name is 2-[(1S,2R)-2-phenylmethoxycyclopentyl]isoindole-1,3-dione.
| Compound Name | 2-[(1S,2R)-2-phenylmethoxycyclopentyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 68810098 |
| Molecular Formula | C20H19NO3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 2-[(1S,2R)-2-phenylmethoxycyclopentyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1[C@H]1CCC[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C20H19NO3/c22-19-15-9-4-5-10-16(15)20(23)21(19)17-11-6-12-18(17)24-13-14-7-2-1-3-8-14/h1-5,7-10,17-18H,6,11-13H2/t17-,18+/m0/s1 |
| InChIKey | SZMFFKNYHHLBBJ-ZWKOTPCHSA-N |
| XLogP | 3.42 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|