About 5-hydroxy-4-oxo-1-[(1S,2S)-2-phenylmethoxycyclohexyl]pyridine-3-carboxylic acid
5-hydroxy-4-oxo-1-[(1S,2S)-2-phenylmethoxycyclohexyl]pyridine-3-carboxylic acid (PubChem CID 58067512) has the molecular formula C19H21NO5
and a molecular weight of 343.38 g/mol. Its IUPAC name is 5-hydroxy-4-oxo-1-[(1S,2S)-2-phenylmethoxycyclohexyl]pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-hydroxy-4-oxo-1-[(1S,2S)-2-phenylmethoxycyclohexyl]pyridine-3-carboxylic acid |
| PubChem CID | 58067512 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 5-hydroxy-4-oxo-1-[(1S,2S)-2-phenylmethoxycyclohexyl]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cn([C@H]2CCCC[C@@H]2OCc2ccccc2)cc(O)c1=O |
| InChI | InChI=1S/C19H21NO5/c21-16-11-20(10-14(18(16)22)19(23)24)15-8-4-5-9-17(15)25-12-13-6-2-1-3-7-13/h1-3,6-7,10-11,15,17,21H,4-5,8-9,12H2,(H,23,24)/t15-,17-/m0/s1 |
| InChIKey | ORHRJFVJWYTKJO-RDJZCZTQSA-N |
| XLogP | 2.95 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-hydroxy-4-oxo-1-[(1S,2S)-2-phenylmethoxycyclohexyl]pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-4-oxo-1-[(1S,2S)-2-phenylmethoxycyclohexyl]pyridine-3-carboxylic acid?
The IUPAC name of 5-hydroxy-4-oxo-1-[(1S,2S)-2-phenylmethoxycyclohexyl]pyridine-3-carboxylic acid (CID 58067512) is 5-hydroxy-4-oxo-1-[(1S,2S)-2-phenylmethoxycyclohexyl]pyridine-3-carboxylic acid.
What is the SMILES notation for 5-hydroxy-4-oxo-1-[(1S,2S)-2-phenylmethoxycyclohexyl]pyridine-3-carboxylic acid?
The canonical SMILES for 5-hydroxy-4-oxo-1-[(1S,2S)-2-phenylmethoxycyclohexyl]pyridine-3-carboxylic acid is O=C(O)c1cn([C@H]2CCCC[C@@H]2OCc2ccccc2)cc(O)c1=O.
What is the InChIKey of 5-hydroxy-4-oxo-1-[(1S,2S)-2-phenylmethoxycyclohexyl]pyridine-3-carboxylic acid?
The InChIKey is ORHRJFVJWYTKJO-RDJZCZTQSA-N. The full InChI is InChI=1S/C19H21NO5/c21-16-11-20(10-14(18(16)22)19(23)24)15-8-4-5-9-17(15)25-12-13-6-2-1-3-7-13/h1-3,6-7,10-11,15,17,21H,4-5,8-9,12H2,(H,23,24)/t15-,17-/m0/s1.
What are the key properties of 5-hydroxy-4-oxo-1-[(1S,2S)-2-phenylmethoxycyclohexyl]pyridine-3-carboxylic acid?
5-hydroxy-4-oxo-1-[(1S,2S)-2-phenylmethoxycyclohexyl]pyridine-3-carboxylic acid has a molecular weight of 343.38 g/mol, XLogP of 2.95, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-4-oxo-1-[(1S,2S)-2-phenylmethoxycyclohexyl]pyridine-3-carboxylic acid is sourced from PubChem (CID 58067512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).