C19H20N2O2 — CID 50956501
6-[(1R,2R)-2-phenylmethoxycyclopentyl]-7H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 50956501) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 6-[(1R,2R)-2-phenylmethoxycyclopentyl]-7H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | 6-[(1R,2R)-2-phenylmethoxycyclopentyl]-7H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 50956501 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 6-[(1R,2R)-2-phenylmethoxycyclopentyl]-7H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | O=C1c2cccnc2CN1[C@@H]1CCC[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C19H20N2O2/c22-19-15-8-5-11-20-16(15)12-21(19)17-9-4-10-18(17)23-13-14-6-2-1-3-7-14/h1-3,5-8,11,17-18H,4,9-10,12-13H2/t17-,18-/m1/s1 |
| InChIKey | WBCWDGONQUNEBK-QZTJIDSGSA-N |
| XLogP | 3.18 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |