C20H21NO2 — CID 102308620
(5S,6R,7R)-7-phenyl-5-phenylmethoxy-1-azabicyclo[4.2.0]octan-8-one (PubChem CID 102308620) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is (5S,6R,7R)-7-phenyl-5-phenylmethoxy-1-azabicyclo[4.2.0]octan-8-one.
| Compound Name | (5S,6R,7R)-7-phenyl-5-phenylmethoxy-1-azabicyclo[4.2.0]octan-8-one |
|---|---|
| PubChem CID | 102308620 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | (5S,6R,7R)-7-phenyl-5-phenylmethoxy-1-azabicyclo[4.2.0]octan-8-one |
| SMILES | O=C1[C@H](c2ccccc2)[C@@H]2[C@@H](OCc3ccccc3)CCCN12 |
| InChI | InChI=1S/C20H21NO2/c22-20-18(16-10-5-2-6-11-16)19-17(12-7-13-21(19)20)23-14-15-8-3-1-4-9-15/h1-6,8-11,17-19H,7,12-14H2/t17-,18+,19-/m0/s1 |
| InChIKey | ZRSYCROAPABRFG-OTWHNJEPSA-N |
| XLogP | 3.36 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |