C20H25NO2 — CID 122383761
[(2S,3S)-1-benzyl-3-phenylmethoxypiperidin-2-yl]methanol (PubChem CID 122383761) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is [(2S,3S)-1-benzyl-3-phenylmethoxypiperidin-2-yl]methanol.
| Compound Name | [(2S,3S)-1-benzyl-3-phenylmethoxypiperidin-2-yl]methanol |
|---|---|
| PubChem CID | 122383761 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | [(2S,3S)-1-benzyl-3-phenylmethoxypiperidin-2-yl]methanol |
| SMILES | OC[C@H]1[C@@H](OCc2ccccc2)CCCN1Cc1ccccc1 |
| InChI | InChI=1S/C20H25NO2/c22-15-19-20(23-16-18-10-5-2-6-11-18)12-7-13-21(19)14-17-8-3-1-4-9-17/h1-6,8-11,19-20,22H,7,12-16H2/t19-,20-/m0/s1 |
| InChIKey | JIEQRBCIKIIHHO-PMACEKPBSA-N |
| XLogP | 3.23 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |