C28H35NO2Si — CID 57385481
[(2R,3S)-1-benzyl-3-[tert-butyl(diphenyl)silyl]oxypyrrolidin-2-yl]methanol (PubChem CID 57385481) has the molecular formula C28H35NO2Si and a molecular weight of 445.68 g/mol. Its IUPAC name is [(2R,3S)-1-benzyl-3-[tert-butyl(diphenyl)silyl]oxypyrrolidin-2-yl]methanol.
| Compound Name | [(2R,3S)-1-benzyl-3-[tert-butyl(diphenyl)silyl]oxypyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 57385481 |
| Molecular Formula | C28H35NO2Si |
| Molecular Weight | 445.68 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | [(2R,3S)-1-benzyl-3-[tert-butyl(diphenyl)silyl]oxypyrrolidin-2-yl]methanol |
| SMILES | CC(C)(C)[Si](O[C@H]1CCN(Cc2ccccc2)[C@@H]1CO)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H35NO2Si/c1-28(2,3)32(24-15-9-5-10-16-24,25-17-11-6-12-18-25)31-27-19-20-29(26(27)22-30)21-23-13-7-4-8-14-23/h4-18,26-27,30H,19-22H2,1-3H3/t26-,27+/m1/s1 |
| InChIKey | BIIFEUKQCSPLNU-SXOMAYOGSA-N |
| XLogP | 4.20 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.68 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|