C32H39NOSi — CID 72722960
[(4aS,7R,7aS)-1-benzyl-2,3,4,4a,7,7a-hexahydrocyclopenta[b]pyridin-7-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 72722960) has the molecular formula C32H39NOSi and a molecular weight of 481.76 g/mol. Its IUPAC name is [(4aS,7R,7aS)-1-benzyl-2,3,4,4a,7,7a-hexahydrocyclopenta[b]pyridin-7-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(4aS,7R,7aS)-1-benzyl-2,3,4,4a,7,7a-hexahydrocyclopenta[b]pyridin-7-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 72722960 |
| Molecular Formula | C32H39NOSi |
| Molecular Weight | 481.76 g/mol |
| Exact Mass | 481.28 |
| IUPAC Name | [(4aS,7R,7aS)-1-benzyl-2,3,4,4a,7,7a-hexahydrocyclopenta[b]pyridin-7-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC[C@@H]1C=C[C@@H]2CCCN(Cc3ccccc3)[C@@H]21)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H39NOSi/c1-32(2,3)35(29-17-9-5-10-18-29,30-19-11-6-12-20-30)34-25-28-22-21-27-16-13-23-33(31(27)28)24-26-14-7-4-8-15-26/h4-12,14-15,17-22,27-28,31H,13,16,23-25H2,1-3H3/t27-,28-,31-/m0/s1 |
| InChIKey | WJSSWJDCCSCDGF-QYDYLWNGSA-N |
| XLogP | 6.03 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.76 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|