C38H45NO3Si — CID 11307843
[(1R,2R,3R,8S)-1,2-bis(phenylmethoxy)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 11307843) has the molecular formula C38H45NO3Si and a molecular weight of 591.87 g/mol. Its IUPAC name is [(1R,2R,3R,8S)-1,2-bis(phenylmethoxy)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(1R,2R,3R,8S)-1,2-bis(phenylmethoxy)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 11307843 |
| Molecular Formula | C38H45NO3Si |
| Molecular Weight | 591.87 g/mol |
| Exact Mass | 591.32 |
| IUPAC Name | [(1R,2R,3R,8S)-1,2-bis(phenylmethoxy)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC[C@@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]2CCCN12)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H45NO3Si/c1-38(2,3)43(32-21-12-6-13-22-32,33-23-14-7-15-24-33)42-29-35-37(41-28-31-19-10-5-11-20-31)36(34-25-16-26-39(34)35)40-27-30-17-8-4-9-18-30/h4-15,17-24,34-37H,16,25-29H2,1-3H3/t34-,35+,36+,37+/m0/s1 |
| InChIKey | JLKYTOYXBFVCPO-UPIAJAFBSA-N |
| XLogP | 6.58 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.87 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|